EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H37N5O9 |
| Net Charge | 0 |
| Average Mass | 467.520 |
| Monoisotopic Mass | 467.25913 |
| SMILES | NC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H](N)C[C@@H]2N)[C@H](N)C[C@@H]1O |
| InChI | InChI=1S/C18H37N5O9/c19-3-9-8(25)2-7(22)17(29-9)31-15-5(20)1-6(21)16(14(15)28)32-18-13(27)11(23)12(26)10(4-24)30-18/h5-18,24-28H,1-4,19-23H2/t5-,6+,7+,8-,9+,10+,11-,12+,13+,14-,15+,16-,17+,18+/m0/s1 |
| InChIKey | NLVFBUXFDBBNBW-PBSUHMDJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tobramycin (CHEBI:28864) has functional parent kanamycin B (CHEBI:28098) |
| tobramycin (CHEBI:28864) has role antibacterial agent (CHEBI:33282) |
| tobramycin (CHEBI:28864) has role antimicrobial agent (CHEBI:33281) |
| tobramycin (CHEBI:28864) has role toxin (CHEBI:27026) |
| tobramycin (CHEBI:28864) is a amino cyclitol glycoside (CHEBI:22479) |
| tobramycin (CHEBI:28864) is conjugate base of tobramycin(5+) (CHEBI:73678) |
| Incoming Relation(s) |
| nebramycin 5' (CHEBI:73686) has functional parent tobramycin (CHEBI:28864) |
| tobramycin(5+) (CHEBI:73678) is conjugate acid of tobramycin (CHEBI:28864) |
| IUPAC Name |
|---|
| (1S,2S,3R,4S,6R)-4,6-diamino-3-(2,6-diamino-2,3,6-trideoxy-α-D-ribo-hexopyranosyloxy)-2-hydroxycyclohexyl 3-amino-3-deoxy-α-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Tobramycin | KEGG COMPOUND |
| Nebramycin factir 6 | KEGG COMPOUND |
| 3'-Deoxykanamycin B | KEGG COMPOUND |
| Tobrex (TN) | KEGG DRUG |
| Tobracin (TN) | KEGG DRUG |
| O-3-Amino-3-deoxy-alpha-D-glucopyranosyl-(1-4)-O-(2,6-diamino-2,3,6-trideoxy-alpha-D-ribohexopyranosyl-(1-4))-2-deoxy-D-streptamine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1357507 | Reaxys |
| CAS:32986-56-4 | KEGG COMPOUND |
| CAS:32986-56-4 | ChemIDplus |
| Citations |
|---|