EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H42N5O9 |
| Net Charge | +5 |
| Average Mass | 472.560 |
| Monoisotopic Mass | 472.29551 |
| SMILES | [NH3+]C[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H]([NH3+])[C@H]3O)[C@H]([NH3+])C[C@@H]2[NH3+])[C@H]([NH3+])C[C@@H]1O |
| InChI | InChI=1S/C18H37N5O9/c19-3-9-8(25)2-7(22)17(29-9)31-15-5(20)1-6(21)16(14(15)28)32-18-13(27)11(23)12(26)10(4-24)30-18/h5-18,24-28H,1-4,19-23H2/p+5/t5-,6+,7+,8-,9+,10+,11-,12+,13+,14-,15+,16-,17+,18+/m0/s1 |
| InChIKey | NLVFBUXFDBBNBW-PBSUHMDJSA-S |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tobramycin(5+) (CHEBI:73678) is a ammonium ion derivative (CHEBI:35274) |
| tobramycin(5+) (CHEBI:73678) is a organic cation (CHEBI:25697) |
| tobramycin(5+) (CHEBI:73678) is conjugate acid of tobramycin (CHEBI:28864) |
| Incoming Relation(s) |
| 4'-adenylyltobramycin(4+) (CHEBI:233205) has functional parent tobramycin(5+) (CHEBI:73678) |
| nebramycin 5'(5+) (CHEBI:73679) has functional parent tobramycin(5+) (CHEBI:73678) |
| tobramycin (CHEBI:28864) is conjugate base of tobramycin(5+) (CHEBI:73678) |
| IUPAC Name |
|---|
| (1S,2S,3R,4S,6R)-4,6-diazaniumyl-3-[(2,6-diazaniumyl-2,3,6-trideoxy-α-D-ribo-hexopyranosyl)oxy]-2-hydroxycyclohexyl 3-azaniumyl-3-deoxy-α-D-glucopyranoside |
| UniProt Name | Source |
|---|---|
| tobramycin | UniProt |
| Citations |
|---|