EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H38N6O10 |
| Net Charge | 0 |
| Average Mass | 510.545 |
| Monoisotopic Mass | 510.26494 |
| SMILES | NC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[C@H]3O[C@H](COC(N)=O)[C@@H](O)[C@H](N)[C@H]3O)[C@H](N)C[C@@H]2N)[C@H](N)C[C@@H]1O |
| InChI | InChI=1S/C19H38N6O10/c20-3-9-8(26)2-7(23)17(32-9)34-15-5(21)1-6(22)16(14(15)29)35-18-13(28)11(24)12(27)10(33-18)4-31-19(25)30/h5-18,26-29H,1-4,20-24H2,(H2,25,30)/t5-,6+,7+,8-,9+,10+,11-,12+,13+,14-,15+,16-,17+,18+/m0/s1 |
| InChIKey | YPPFEJHOHNPKLT-PBSUHMDJSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nebramycin 5' (CHEBI:73686) has functional parent tobramycin (CHEBI:28864) |
| nebramycin 5' (CHEBI:73686) is a carbamoylkanamycin (CHEBI:73684) |
| nebramycin 5' (CHEBI:73686) is conjugate base of nebramycin 5'(5+) (CHEBI:73679) |
| Incoming Relation(s) |
| nebramycin 5'(5+) (CHEBI:73679) is conjugate acid of nebramycin 5' (CHEBI:73686) |
| IUPAC Name |
|---|
| (1S,2S,3R,4S,6R)-4,6-diamino-3-[(2,6-diamino-2,3,6-trideoxy-α-D-ribo-hexopyranosyl)oxy]-2-hydroxycyclohexyl 3-amino-6-O-carbamoyl-3-deoxy-α-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 6''-O-Carbamoyltobramycin | ChemIDplus |
| Nebramycin factor 5' | KEGG COMPOUND |
| Nebramycin factor 5' | ChemIDplus |
| Nebramycin V' | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1360292 | Reaxys |
| CAS:51736-77-7 | KEGG COMPOUND |
| CAS:51736-77-7 | ChemIDplus |
| Citations |
|---|