EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H27N3O15 |
| Net Charge | 0 |
| Average Mass | 669.552 |
| Monoisotopic Mass | 669.14422 |
| SMILES | O=C(N[C@H]1COC(=O)[C@@H](NC(=O)c2cccc(O)c2O)COC(=O)[C@@H](NC(=O)c2cccc(O)c2O)COC1=O)c1cccc(O)c1O |
| InChI | InChI=1S/C30H27N3O15/c34-19-7-1-4-13(22(19)37)25(40)31-16-10-46-29(44)18(33-27(42)15-6-3-9-21(36)24(15)39)12-48-30(45)17(11-47-28(16)43)32-26(41)14-5-2-8-20(35)23(14)38/h1-9,16-18,34-39H,10-12H2,(H,31,40)(H,32,41)(H,33,42)/t16-,17-,18-/m0/s1 |
| InChIKey | SERBHKJMVBATSJ-BZSNNMDCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enterobactin (CHEBI:28855) has role bacterial metabolite (CHEBI:76969) |
| enterobactin (CHEBI:28855) has role siderophore (CHEBI:26672) |
| enterobactin (CHEBI:28855) is a catechols (CHEBI:33566) |
| enterobactin (CHEBI:28855) is a crown compound (CHEBI:37409) |
| enterobactin (CHEBI:28855) is a macrotriolide (CHEBI:145559) |
| enterobactin (CHEBI:28855) is a polyphenol (CHEBI:26195) |
| enterobactin (CHEBI:28855) is conjugate acid of enterobactin(1−) (CHEBI:77805) |
| enterobactin (CHEBI:28855) is conjugate acid of enterobactin(6−) (CHEBI:38150) |
| Incoming Relation(s) |
| diglucosyl-enterobactin (CHEBI:142959) has functional parent enterobactin (CHEBI:28855) |
| monoglucosyl-enterobactin (CHEBI:142958) has functional parent enterobactin (CHEBI:28855) |
| triglucosyl-enterobactin (CHEBI:142960) has functional parent enterobactin (CHEBI:28855) |
| enterobactin(1−) (CHEBI:77805) is conjugate base of enterobactin (CHEBI:28855) |
| enterobactin(6−) (CHEBI:38150) is conjugate base of enterobactin (CHEBI:28855) |
| IUPAC Name |
|---|
| N,N',N''-[(3S,7S,11S)-2,6,10-trioxo-1,5,9-trioxacyclododecane-3,7,11-triyl]tris(2,3-dihydroxybenzamide) |
| Synonyms | Source |
|---|---|
| Enterochelin | KEGG COMPOUND |
| Enterobactin | KEGG COMPOUND |
| Tri-(N-(2,3-dihydroxybenzoyl)-L-serine)-ester | KEGG COMPOUND |
| Tri-(2,3-dihydroxy-N-benzoyl-L-serine)-ester | KEGG COMPOUND |
| (3S-(3R*,7R*,11R*))-N,N',N''-(2,6,10-trioxo-1,5,9-trioxacyclododecane-3,7,11-triyl)tris(2,3-dihydroxybenzamide) | ChemIDplus |
| H6ent | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1420020 | Beilstein |
| Gmelin:781435 | Gmelin |
| CAS:28384-96-5 | ChemIDplus |
| CAS:28384-96-5 | KEGG COMPOUND |