EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H21N3O15 |
| Net Charge | -6 |
| Average Mass | 663.504 |
| Monoisotopic Mass | 663.10056 |
| SMILES | O=C(N[C@H]1COC(=O)[C@@H](NC(=O)c2cccc([O-])c2[O-])COC(=O)[C@@H](NC(=O)c2cccc([O-])c2[O-])COC1=O)c1cccc([O-])c1[O-] |
| InChI | InChI=1S/C30H27N3O15/c34-19-7-1-4-13(22(19)37)25(40)31-16-10-46-29(44)18(33-27(42)15-6-3-9-21(36)24(15)39)12-48-30(45)17(11-47-28(16)43)32-26(41)14-5-2-8-20(35)23(14)38/h1-9,16-18,34-39H,10-12H2,(H,31,40)(H,32,41)(H,33,42)/p-6/t16-,17-,18-/m0/s1 |
| InChIKey | SERBHKJMVBATSJ-BZSNNMDCSA-H |
| Roles Classification |
|---|
| Chemical Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| Biological Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enterobactin(6−) (CHEBI:38150) has role siderophore (CHEBI:26672) |
| enterobactin(6−) (CHEBI:38150) is a phenolate anion (CHEBI:50525) |
| enterobactin(6−) (CHEBI:38150) is conjugate base of enterobactin (CHEBI:28855) |
| Incoming Relation(s) |
| Fe(III)-C-5-deoxy-β-D-glucosyl-enterobactin(3−) (CHEBI:143772) has functional parent enterobactin(6−) (CHEBI:38150) |
| Fe(III)-di(C-5-deoxy-β-D-glucosyl)-enterobactin(3−) (CHEBI:143771) has functional parent enterobactin(6−) (CHEBI:38150) |
| ferrienterobactin(3−) (CHEBI:28199) has part enterobactin(6−) (CHEBI:38150) |
| enterobactin (CHEBI:28855) is conjugate acid of enterobactin(6−) (CHEBI:38150) |
| IUPAC Name |
|---|
| 3,3',3''-{[(3S,7S,11S)-2,6,10-trioxo-1,5,9-trioxacyclododecane-3,7,11-triyl]tris(iminocarbonyl)}tribenzene-1,2-diolate |
| Synonym | Source |
|---|---|
| ent6− | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:2491631 | Gmelin |