EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H26N3O15 |
| Net Charge | -1 |
| Average Mass | 668.544 |
| Monoisotopic Mass | 668.13694 |
| SMILES | O=C(N[C@H]1COC(=O)[C@@H](NC(=O)c2cccc(O)c2O)COC(=O)[C@@H](NC(=O)c2cccc(O)c2O)COC1=O)c1cccc(O)c1[O-] |
| InChI | InChI=1S/C30H27N3O15/c34-19-7-1-4-13(22(19)37)25(40)31-16-10-46-29(44)18(33-27(42)15-6-3-9-21(36)24(15)39)12-48-30(45)17(11-47-28(16)43)32-26(41)14-5-2-8-20(35)23(14)38/h1-9,16-18,34-39H,10-12H2,(H,31,40)(H,32,41)(H,33,42)/p-1/t16-,17-,18-/m0/s1 |
| InChIKey | SERBHKJMVBATSJ-BZSNNMDCSA-M |
| Roles Classification |
|---|
| Chemical Role: | siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. siderophore Any of low-molecular-mass iron(III)-chelating compounds produced by microorganisms for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| enterobactin(1−) (CHEBI:77805) has role bacterial metabolite (CHEBI:76969) |
| enterobactin(1−) (CHEBI:77805) has role siderophore (CHEBI:26672) |
| enterobactin(1−) (CHEBI:77805) is a phenolate anion (CHEBI:50525) |
| enterobactin(1−) (CHEBI:77805) is conjugate base of enterobactin (CHEBI:28855) |
| Incoming Relation(s) |
| enterobactin (CHEBI:28855) is conjugate acid of enterobactin(1−) (CHEBI:77805) |
| IUPAC Name |
|---|
| 2-({(3S,7S,11S)-7,11-bis[(2,3-dihydroxybenzoyl)amino]-2,6,10-trioxo-1,5,9-trioxacyclododecan-3-yl}carbamoyl)-6-hydroxyphenolate |
| UniProt Name | Source |
|---|---|
| enterobactin | UniProt |