EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26N2 |
| Net Charge | 0 |
| Average Mass | 234.387 |
| Monoisotopic Mass | 234.20960 |
| SMILES | [H][C@@]12CCCCN1C[C@@H]1C[C@H]2CN2CCCC[C@]12[H] |
| InChI | InChI=1S/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2/t12-,13-,14-,15+/m0/s1 |
| InChIKey | SLRCCWJSBJZJBV-ZQDZILKHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sparteine (CHEBI:28827) is a quinolizidine alkaloid (CHEBI:26515) |
| sparteine (CHEBI:28827) is a quinolizidine alkaloid fundamental parent (CHEBI:38526) |
| Incoming Relation(s) |
| 2,3-didehydrosparteine (CHEBI:29130) has functional parent sparteine (CHEBI:28827) |
| 5,6-didehydrosparteine (CHEBI:143195) has functional parent sparteine (CHEBI:28827) |
| lupanine (CHEBI:28193) has parent hydride sparteine (CHEBI:28827) |
| IUPAC Name |
|---|
| sparteine |
| Synonyms | Source |
|---|---|
| 6β,7α,9α,11α-pachycarpine | NIST Chemistry WebBook |
| (7S,7aS,14S,14aR)-dodecahydro-7,14-methano-2H,6H-dipyrido[1,2-a:1',2'-e][1,5]diazocine | ChEBI |
| [7S-(7α,7aα,14α,14aβ)]-dodecahydro-7,14-methano-2H,6H-dipyrido[1,2-a:1',2'-e][1,5]diazocine | NIST Chemistry WebBook |
| l-sparteine | ChemIDplus |
| lupinidine | ChemIDplus |
| (-)-Sparteine | KEGG COMPOUND |