EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24N2O |
| Net Charge | 0 |
| Average Mass | 248.370 |
| Monoisotopic Mass | 248.18886 |
| SMILES | [H][C@]12CN3CCCC[C@@]3([H])[C@]([H])(CN3C(=O)CCC[C@@]31[H])C2 |
| InChI | InChI=1S/C15H24N2O/c18-15-6-3-5-14-11-8-12(10-17(14)15)13-4-1-2-7-16(13)9-11/h11-14H,1-10H2/t11-,12-,13-,14+/m0/s1 |
| InChIKey | JYIJIIVLEOETIQ-XDQVBPFNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lupanine (CHEBI:28193) has parent hydride sparteine (CHEBI:28827) |
| lupanine (CHEBI:28193) is a quinolizidine alkaloid (CHEBI:26515) |
| lupanine (CHEBI:28193) is a tertiary amine (CHEBI:32876) |
| lupanine (CHEBI:28193) is a δ-lactam (CHEBI:77727) |
| lupanine (CHEBI:28193) is conjugate base of lupanine(1+) (CHEBI:64261) |
| Incoming Relation(s) |
| 13-(2-methylcrotonoyloxy)lupanine (CHEBI:18360) has functional parent lupanine (CHEBI:28193) |
| 13-hydroxylupanine (CHEBI:18328) has functional parent lupanine (CHEBI:28193) |
| 17-hydroxylupanine (CHEBI:64287) has functional parent lupanine (CHEBI:28193) |
| lupanine(1+) (CHEBI:64261) is conjugate acid of lupanine (CHEBI:28193) |
| IUPAC Name |
|---|
| spartein-2-one |
| Synonyms | Source |
|---|---|
| (+)-2-oxosparteine | ChEBI |
| 2-oxosparteine | ChemIDplus |
| (7alpha,7aalpha,14alpha,14abeta)-dodecahydro-7,14-methano-2H,11H-dipyridol[1,2-a:1',2'-e][1,5]diazocin-11-one | ChEBI |
| d-lupanine | ChEBI |
| lupanine | ChEMBL |
| (+)-Lupanine | KEGG COMPOUND |
| Citations |
|---|