EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24N2 |
| Net Charge | 0 |
| Average Mass | 232.371 |
| Monoisotopic Mass | 232.19395 |
| SMILES | [H][C@@]12CCCCN1C[C@@H]1C[C@H]2CN2C=CCC[C@]12[H] |
| InChI | InChI=1S/C15H24N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h3,7,12-15H,1-2,4-6,8-11H2/t12-,13-,14+,15-/m0/s1 |
| InChIKey | BWKNRAAXVUYXAH-XQLPTFJDSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-didehydrosparteine (CHEBI:29130) has functional parent sparteine (CHEBI:28827) |
| 2,3-didehydrosparteine (CHEBI:29130) is a quinolizidine alkaloid (CHEBI:26515) |
| IUPAC Name |
|---|
| 2,3-didehydrosparteine |
| Synonyms | Source |
|---|---|
| 2-dehydrosparteine | ChemIDplus |
| (7S,7aR,14R,14aS)-1,3,4,7,7a,8,9,13,14,14a-decahydro-7,14-methano-2H,6H-dipyrido[1,2-a:1',2'-e][1,5]diazocine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14625 | Reaxys |
| CAS:67528-17-0 | ChemIDplus |