EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24O7 |
| Net Charge | 0 |
| Average Mass | 388.416 |
| Monoisotopic Mass | 388.15220 |
| SMILES | COc1cc(C2Oc3c(OC)cc(/C=C/CO)cc3C2CO)cc(OC)c1O |
| InChI | InChI=1S/C21H24O7/c1-25-16-9-13(10-17(26-2)19(16)24)20-15(11-23)14-7-12(5-4-6-22)8-18(27-3)21(14)28-20/h4-5,7-10,15,20,22-24H,6,11H2,1-3H3/b5-4+ |
| InChIKey | SGRRPSBKBJVKJE-SNAWJCMRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| root (BTO:0001188) | PubMed (25457500) | ||
| root (BTO:0001188) | MetaboLights (MTBLS160) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| simulanol (CHEBI:86940) has functional parent coniferol (CHEBI:17745) |
| simulanol (CHEBI:86940) has functional parent sinapyl alcohol (CHEBI:28813) |
| simulanol (CHEBI:86940) has role plant metabolite (CHEBI:76924) |
| simulanol (CHEBI:86940) is a 1-benzofurans (CHEBI:38830) |
| simulanol (CHEBI:86940) is a dimethoxybenzene (CHEBI:51681) |
| simulanol (CHEBI:86940) is a guaiacyl lignin (CHEBI:64475) |
| simulanol (CHEBI:86940) is a phenols (CHEBI:33853) |
| simulanol (CHEBI:86940) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| 4-{3-(hydroxymethyl)-5-[(1E)-3-hydroxyprop-1-en-1-yl]-7-methoxy-2,3-dihydro-1-benzofuran-2-yl}-2,6-dimethoxyphenol |
| Synonyms | Source |
|---|---|
| 5'-methoxydehydrodiconiferyl alcohol | ChEBI |
| S(8-5)G | ChEBI |