EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O4 |
| Net Charge | 0 |
| Average Mass | 256.257 |
| Monoisotopic Mass | 256.07356 |
| SMILES | O=C1C[C@@H](c2ccc(O)cc2)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C15H12O4/c16-10-3-1-9(2-4-10)14-8-13(18)12-6-5-11(17)7-15(12)19-14/h1-7,14,16-17H,8H2/t14-/m0/s1 |
| InChIKey | FURUXTVZLHCCNA-AWEZNQCLSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza glabra (ncbitaxon:49827) | - | PubMed (21866899) | |
| Platymiscium floribundum (ncbitaxon:500185) | - | PubMed (21866899) |
| Roles Classification |
|---|
| Biological Roles: | hormone agonist A chemical substance which binds to specific hormone receptors activating the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Brassica napus metabolite Any plant metabolite that is produced by rapeseed (Brassica napus). fungal xenobiotic metabolite Any fungal metabolite produced by metabolism of a xenobiotic compound in fungi. |
| Application: | hormone agonist A chemical substance which binds to specific hormone receptors activating the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| liquiritigenin (CHEBI:28777) has role hormone agonist (CHEBI:51060) |
| liquiritigenin (CHEBI:28777) has role plant metabolite (CHEBI:76924) |
| liquiritigenin (CHEBI:28777) is a 4',7-dihydroxyflavanone (CHEBI:136678) |
| Incoming Relation(s) |
| liquiritin (CHEBI:80845) has functional parent liquiritigenin (CHEBI:28777) |
| IUPAC Name |
|---|
| (2S)-7-hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| (2S)-7-Hydroxy-2-(4-hydroxyphenyl)-2,3-dihydro-4H-1-benzopyran-4-one | ChemIDplus |
| (2S)-liquiritigenin | ChEMBL |
| 4',7-Dihydroxyflavanone | ChemIDplus |
| 7,4'-Dihydroxyflavanone | KEGG COMPOUND |
| 7-HYDROXY-2-(4-HYDROXY-PHENYL)-CHROMAN-4-ONE | PDBeChem |
| (−)-liquiritigenin | ChEBI |
| UniProt Name | Source |
|---|---|
| (2S)-liquiritigenin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00000977 | KNApSAcK |
| C09762 | KEGG COMPOUND |
| DFV | PDBeChem |
| HMDB0029519 | HMDB |
| Liquiritigenin | Wikipedia |
| LMPK12140061 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3593780 | Reaxys |
| CAS:578-86-9 | ChemIDplus |
| CAS:578-86-9 | KEGG COMPOUND |
| Citations |
|---|