EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:80845 - liquiritin
| Formula | C21H22O9 |
| Net Charge | 0 |
| Average Mass | 418.398 |
| Monoisotopic Mass | 418.12638 |
| SMILES | O=C1C[C@@H](c2ccc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)cc2)Oc2cc(O)ccc21 |
| InChI | InChI=1S/C21H22O9/c22-9-17-18(25)19(26)20(27)21(30-17)28-12-4-1-10(2-5-12)15-8-14(24)13-6-3-11(23)7-16(13)29-15/h1-7,15,17-23,25-27H,8-9H2/t15-,17+,18+,19-,20+,21+/m0/s1 |
| InChIKey | DEMKZLAVQYISIA-ZRWXNEIDSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Glycyrrhiza uralensis (ncbitaxon:74613) | - | PubMed (25744461) | |
| Glycyrrhiza glabra (ncbitaxon:49827) | - | Article (Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).) |
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| liquiritin (CHEBI:80845) has functional parent liquiritigenin (CHEBI:28777) |
| liquiritin (CHEBI:80845) has role anti-inflammatory agent (CHEBI:67079) |
| liquiritin (CHEBI:80845) has role anticoronaviral agent (CHEBI:149553) |
| liquiritin (CHEBI:80845) has role plant metabolite (CHEBI:76924) |
| liquiritin (CHEBI:80845) is a flavanone glycoside (CHEBI:72730) |
| liquiritin (CHEBI:80845) is a monohydroxyflavanone (CHEBI:38748) |
| liquiritin (CHEBI:80845) is a monosaccharide derivative (CHEBI:63367) |
| liquiritin (CHEBI:80845) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 4-[(2S)-7-hydroxy-4-oxo-3,4-dihydro-2H-1-benzopyran-2-yl]phenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| liquiritigenin-4'-β-D-glucoside | KEGG COMPOUND |
| 4'-O-β-D-glucopyranosyl-7-hydroxyflavan-4-one | ChEBI |
| liquiritoside | MetaCyc |
| likviritin | ChemIDplus |
| 7-hydroxyflavanone 4'-O-β-D-glucoside | ChEBI |
| 7-hydroxyflavanone 4'-O-glucoside | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C16989 | KEGG COMPOUND |
| LMPK12140021 | LIPID MAPS |
| Liquiritin | Wikipedia |
| HMDB0029520 | HMDB |
| CPD-21623 | MetaCyc |
| C00008193 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:61653 | Reaxys |
| CAS:551-15-5 | KEGG COMPOUND |
| CAS:551-15-5 | ChemIDplus |
| Citations |
|---|