EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O6 |
| Net Charge | 0 |
| Average Mass | 370.486 |
| Monoisotopic Mass | 370.23554 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1OC(O)C[C@H](O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H34O6/c1-2-3-6-9-15(21)12-13-18-16(17(22)14-20(25)26-18)10-7-4-5-8-11-19(23)24/h4,7,12-13,15-18,20-22,25H,2-3,5-6,8-11,14H2,1H3,(H,23,24)/b7-4-,13-12+/t15-,16-,17-,18+,20?/m0/s1 |
| InChIKey | XNRNNGPBEPRNAR-JQBLCGNGSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS143) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thromboxane B2 (CHEBI:28728) has role human metabolite (CHEBI:77746) |
| thromboxane B2 (CHEBI:28728) has role mouse metabolite (CHEBI:75771) |
| thromboxane B2 (CHEBI:28728) is a thromboxanes B (CHEBI:26996) |
| thromboxane B2 (CHEBI:28728) is conjugate acid of thromboxane B2(1−) (CHEBI:90696) |
| Incoming Relation(s) |
| 11-dehydro-thromboxane B2 (CHEBI:28667) has functional parent thromboxane B2 (CHEBI:28728) |
| thromboxane B2(1−) (CHEBI:90696) is conjugate base of thromboxane B2 (CHEBI:28728) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-9α,11,15-trihydroxythromboxa-5,13-dien-1-oic acid |
| Synonyms | Source |
|---|---|
| Thromboxane B2 | KEGG COMPOUND |
| TXB2 | LIPID MAPS |
| TXB2 | ChEBI |
| TXB2 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05963 | KEGG COMPOUND |
| LMFA03030002 | LIPID MAPS |
| HMDB0003252 | HMDB |
| Thromboxane_B2 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1399489 | Reaxys |
| CAS:54397-85-2 | ChemIDplus |
| CAS:54397-85-2 | KEGG COMPOUND |
| Citations |
|---|