EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33O6 |
| Net Charge | -1 |
| Average Mass | 369.478 |
| Monoisotopic Mass | 369.22826 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1OC(O)C[C@H](O)[C@@H]1C/C=C\CCCC(=O)[O-] |
| InChI | InChI=1S/C20H34O6/c1-2-3-6-9-15(21)12-13-18-16(17(22)14-20(25)26-18)10-7-4-5-8-11-19(23)24/h4,7,12-13,15-18,20-22,25H,2-3,5-6,8-11,14H2,1H3,(H,23,24)/p-1/b7-4-,13-12+/t15-,16-,17-,18+,20?/m0/s1 |
| InChIKey | XNRNNGPBEPRNAR-JQBLCGNGSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thromboxane B2(1−) (CHEBI:90696) is a thromboxane anion (CHEBI:62945) |
| thromboxane B2(1−) (CHEBI:90696) is conjugate base of thromboxane B2 (CHEBI:28728) |
| Incoming Relation(s) |
| thromboxane B2 (CHEBI:28728) is conjugate acid of thromboxane B2(1−) (CHEBI:90696) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-9α,11,15-trihydroxythromboxa-5,13-dien-1-oate |
| UniProt Name | Source |
|---|---|
| thromboxane B2 | UniProt |
| Citations |
|---|