EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32O6 |
| Net Charge | 0 |
| Average Mass | 368.470 |
| Monoisotopic Mass | 368.21989 |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1OC(=O)C[C@H](O)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O6/c1-2-3-6-9-15(21)12-13-18-16(17(22)14-20(25)26-18)10-7-4-5-8-11-19(23)24/h4,7,12-13,15-18,21-22H,2-3,5-6,8-11,14H2,1H3,(H,23,24)/b7-4-,13-12+/t15-,16-,17-,18+/m0/s1 |
| InChIKey | KJYIVXDPWBUJBQ-UHHGALCXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-dehydro-thromboxane B2 (CHEBI:28667) has functional parent thromboxane B2 (CHEBI:28728) |
| 11-dehydro-thromboxane B2 (CHEBI:28667) has role human metabolite (CHEBI:77746) |
| 11-dehydro-thromboxane B2 (CHEBI:28667) is a thromboxane (CHEBI:26995) |
| 11-dehydro-thromboxane B2 (CHEBI:28667) is conjugate acid of 11-dehydro-thromboxane B2(1−) (CHEBI:136539) |
| Incoming Relation(s) |
| 11-dehydro-thromboxane B2(1−) (CHEBI:136539) is conjugate base of 11-dehydro-thromboxane B2 (CHEBI:28667) |
| IUPAC Name |
|---|
| (5Z,13E,15S)-9α,15-dihydroxy-11-oxothromboxa-5,13-dien-1-oic acid |
| Synonyms | Source |
|---|---|
| 11-Dehydro-thromboxane B2 | KEGG COMPOUND |
| 11-Dehydro-txb2 | ChemIDplus |
| 11-Dehydrothromboxane B2 | ChemIDplus |
| 11-Keto-thromboxane B2 | ChemIDplus |
| 11-dehydro-TXB2 | LIPID MAPS |
| 11-dehydro-TXB2 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05964 | KEGG COMPOUND |
| LMFA03030004 | LIPID MAPS |
| HMDB0004242 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5826438 | Reaxys |
| CAS:67910-12-7 | ChemIDplus |
| CAS:67910-12-7 | KEGG COMPOUND |