EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H39N2O6S |
| Net Charge | -1 |
| Average Mass | 495.662 |
| Monoisotopic Mass | 495.25343 |
| SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H]([NH3+])C(=O)NCC(=O)[O-])[C@@H](O)CCCC(=O)[O-] |
| InChI | InChI=1S/C25H40N2O6S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-22(21(28)15-14-17-23(29)30)34-19-20(26)25(33)27-18-24(31)32/h6-7,9-13,16,20-22,28H,2-5,8,14-15,17-19,26H2,1H3,(H,27,33)(H,29,30)(H,31,32)/p-1/b7-6-,10-9-,12-11+,16-13+/t20-,21-,22+/m0/s1 |
| InChIKey | YEESKJGWJFYOOK-IJHYULJSSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leukotriene D4(1−) (CHEBI:63166) is a leukotriene anion (CHEBI:62942) |
| leukotriene D4(1−) (CHEBI:63166) is a peptide anion (CHEBI:60334) |
| leukotriene D4(1−) (CHEBI:63166) is conjugate base of leukotriene D4 (CHEBI:28666) |
| Incoming Relation(s) |
| leukotriene D4 (CHEBI:28666) is conjugate acid of leukotriene D4(1−) (CHEBI:63166) |
| IUPAC Names |
|---|
| S-{(1R,2E,4E,6Z,9Z)-1-[(1S)-4-carboxylato-1-hydroxybutyl]pentadeca-2,4,6,9-tetraen-1-yl}-L-cysteinylglycinate |
| (5S,6R,7E,9E,11Z,14Z)-6-({(2R)-2-amino-3-[(carboxylatomethyl)amino]-3-oxopropyl}sulfanyl)-5-hydroxyicosa-7,9,11,14-tetraenoate |
| Synonyms | Source |
|---|---|
| leukotriene D4 anion | ChEBI |
| leukotriene D4 monoanion | ChEBI |
| UniProt Name | Source |
|---|---|
| leukotriene D4 | UniProt |