EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | CC(C)=CCC/C(C)=C\CC/C(C)=C/CO |
| InChI | InChI=1S/C15H26O/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11,16H,5-6,8,10,12H2,1-4H3/b14-9-,15-11+ |
| InChIKey | CRDAMVZIKSXKFV-GNESMGCMSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2-trans,6-cis)-farnesol (CHEBI:35966) is a farnesol (CHEBI:28600) |
| IUPAC Name |
|---|
| (2E,6Z)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
| Synonyms | Source |
|---|---|
| (2E,6Z)-farnesol | NIST Chemistry WebBook |
| (2-trans,6-cis)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol | IUPAC |
| (E,Z)-3,7,11-trimethyl-2,6,10-dodecatrien-1-ol | NIST Chemistry WebBook |
| 2-trans,6-cis-farnesol | ChEBI |
| (E,Z)-farnesol | NIST Chemistry WebBook |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1723037 | Beilstein |
| CAS:3879-60-5 | NIST Chemistry WebBook |