EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14O6 |
| Net Charge | 0 |
| Average Mass | 194.183 |
| Monoisotopic Mass | 194.07904 |
| SMILES | CO[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2-,3-,4-,5-,6+,7+/m0/s1 |
| InChIKey | DSCFFEYYQKSRSV-KLJZZCKASA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Genista ephedroides (ncbitaxon:123905) | - | DOI (10.1021/np980112s) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-pinitol (CHEBI:28548) has functional parent 1D-chiro-inositol (CHEBI:27372) |
| D-pinitol (CHEBI:28548) has role compatible osmolytes (CHEBI:23366) |
| D-pinitol (CHEBI:28548) has role geroprotector (CHEBI:176497) |
| D-pinitol (CHEBI:28548) is a pinitol (CHEBI:37208) |
| D-pinitol (CHEBI:28548) is enantiomer of L-pinitol (CHEBI:37209) |
| Incoming Relation(s) |
| L-pinitol (CHEBI:37209) is enantiomer of D-pinitol (CHEBI:28548) |
| IUPAC Name |
|---|
| 1D-3-O-methyl-chiro-inositol |
| Synonyms | Source |
|---|---|
| 1D-3-O-Methyl-chiro-inositol | KEGG COMPOUND |
| (1R,2S,3R,4S,5S,6S)-6-methoxycyclohexane-1,2,3,4,5-pentol | IUPAC |
| 5D-5-O-Methyl-chiro-inositol | KEGG COMPOUND |
| D-Pinitol | KEGG COMPOUND |
| Pinit | ChemIDplus |
| (+)-pinitol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 5D-5-O-methyl-chiro-inositol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2043789 | Beilstein |
| Beilstein:4291950 | Beilstein |
| CAS:10284-63-6 | ChemIDplus |
| CAS:10284-63-6 | KEGG COMPOUND |
| Citations |
|---|