EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14O6 |
| Net Charge | 0 |
| Average Mass | 194.183 |
| Monoisotopic Mass | 194.07904 |
| SMILES | CO[C@H]1[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2-,3-,4-,5-,6+,7+/m1/s1 |
| InChIKey | DSCFFEYYQKSRSV-FQGZZYRYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-pinitol (CHEBI:37209) has functional parent 1L-chiro-inositol (CHEBI:27374) |
| L-pinitol (CHEBI:37209) is a pinitol (CHEBI:37208) |
| L-pinitol (CHEBI:37209) is enantiomer of D-pinitol (CHEBI:28548) |
| Incoming Relation(s) |
| D-pinitol (CHEBI:28548) is enantiomer of L-pinitol (CHEBI:37209) |
| IUPAC Name |
|---|
| 1L-3-O-methyl-chiro-inositol |
| Synonyms | Source |
|---|---|
| (1R,2R,3S,4R,5S,6R)-6-methoxycyclohexane-1,2,3,4,5-pentol | IUPAC |
| 3-O-methyl-1L-chiro-Inositol | ChEBI |
| 3-O-methyl-L-chiro-inositol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 21865292 | ChemSpider |
| FDB012527 | FooDB |
| HMDB0034222 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2501220 | Reaxys |
| CAS:3559-00-0 | HMDB |