EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | O[C@H]1[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4-,5+,6+/m0/s1 |
| InChIKey | CDAISMWEOUEBRE-LKPKBOIGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1D-chiro-inositol (CHEBI:27372) has role geroprotector (CHEBI:176497) |
| 1D-chiro-inositol (CHEBI:27372) is a chiro-inositol (CHEBI:23098) |
| 1D-chiro-inositol (CHEBI:27372) is enantiomer of 1L-chiro-inositol (CHEBI:27374) |
| Incoming Relation(s) |
| D-pinitol (CHEBI:28548) has functional parent 1D-chiro-inositol (CHEBI:27372) |
| 1D-5-O-methyl-chiro-inositol (CHEBI:18173) has functional parent 1D-chiro-inositol (CHEBI:27372) |
| 2D-2,3,5/4,6-pentahydroxycyclohexanone (CHEBI:50920) has functional parent 1D-chiro-inositol (CHEBI:27372) |
| fagopyritol A1 (CHEBI:156276) has functional parent 1D-chiro-inositol (CHEBI:27372) |
| fagopyritol B1 (CHEBI:133330) has functional parent 1D-chiro-inositol (CHEBI:27372) |
| validamine (CHEBI:30449) has functional parent 1D-chiro-inositol (CHEBI:27372) |
| 1L-chiro-inositol (CHEBI:27374) is enantiomer of 1D-chiro-inositol (CHEBI:27372) |
| IUPAC Name |
|---|
| 1D-chiro-inositol |
| Synonyms | Source |
|---|---|
| 1,2,4/3,5,6-cyclohexanehexol | IUPAC |
| (1R,2R,3S,4S,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol | IUPAC |
| cis-1,2,4-trans-3,5,6-Cyclohexanehexol | SUBMITTER |
| DCI | SUBMITTER |
| (+)-chiro-inositol | ChEBI |
| (+)-Inositol | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 1D-chiro-inositol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 10254647 | ChemSpider |
| 1D-chiro-Inositol | Wikipedia |
| C00053119 | KNApSAcK |
| C19891 | KEGG COMPOUND |
| CBU | PDBeChem |
| DB15350 | DrugBank |
| FDB001138 | FooDB |
| HMDB0240209 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:643-12-9 | ChemIDplus |
| Citations |
|---|