EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O3 |
| Net Charge | 0 |
| Average Mass | 130.143 |
| Monoisotopic Mass | 130.06299 |
| SMILES | CCCC(=O)CC(=O)O |
| InChI | InChI=1S/C6H10O3/c1-2-3-5(7)4-6(8)9/h2-4H2,1H3,(H,8,9) |
| InChIKey | BDCLDNALSPBWPQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxohexanoic acid (CHEBI:28422) has functional parent hexanoic acid (CHEBI:30776) |
| 3-oxohexanoic acid (CHEBI:28422) is a 3-oxo monocarboxylic acid (CHEBI:47881) |
| Incoming Relation(s) |
| N-(3-oxohexanoyl)homoserine lactone (CHEBI:29640) has functional parent 3-oxohexanoic acid (CHEBI:28422) |
| 3-oxohexanoyl-CoA (CHEBI:27648) has functional parent 3-oxohexanoic acid (CHEBI:28422) |
| 6-acetamido-3-oxohexanoic acid (CHEBI:2165) has functional parent 3-oxohexanoic acid (CHEBI:28422) |
| ethyl 3-oxohexanoate (CHEBI:18119) has functional parent 3-oxohexanoic acid (CHEBI:28422) |
| IUPAC Name |
|---|
| 3-oxohexanoic acid |
| Synonyms | Source |
|---|---|
| 3-Oxohexanoate | KEGG COMPOUND |
| 3-Oxohexanoic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C02122 | KEGG COMPOUND |
| LMFA01060008 | LIPID MAPS |