EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44N7O18P3S |
| Net Charge | 0 |
| Average Mass | 879.669 |
| Monoisotopic Mass | 879.16764 |
| SMILES | CCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C27H44N7O18P3S/c1-4-5-15(35)10-18(37)56-9-8-29-17(36)6-7-30-25(40)22(39)27(2,3)12-49-55(46,47)52-54(44,45)48-11-16-21(51-53(41,42)43)20(38)26(50-16)34-14-33-19-23(28)31-13-32-24(19)34/h13-14,16,20-22,26,38-39H,4-12H2,1-3H3,(H,29,36)(H,30,40)(H,44,45)(H,46,47)(H2,28,31,32)(H2,41,42,43)/t16-,20-,21-,22+,26-/m1/s1 |
| InChIKey | NFOYYXQAVVYWKV-HDRQGHTBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-oxohexanoyl-CoA (CHEBI:27648) has functional parent 3-oxohexanoic acid (CHEBI:28422) |
| 3-oxohexanoyl-CoA (CHEBI:27648) has functional parent hexanoyl-CoA (CHEBI:27540) |
| 3-oxohexanoyl-CoA (CHEBI:27648) has role Escherichia coli metabolite (CHEBI:76971) |
| 3-oxohexanoyl-CoA (CHEBI:27648) has role human metabolite (CHEBI:77746) |
| 3-oxohexanoyl-CoA (CHEBI:27648) has role mouse metabolite (CHEBI:75771) |
| 3-oxohexanoyl-CoA (CHEBI:27648) is a 3-oxo-fatty acyl-CoA (CHEBI:15489) |
| 3-oxohexanoyl-CoA (CHEBI:27648) is conjugate acid of 3-oxohexanoyl-CoA(4−) (CHEBI:62418) |
| Incoming Relation(s) |
| 3-oxohexanoyl-CoA(4−) (CHEBI:62418) is conjugate base of 3-oxohexanoyl-CoA (CHEBI:27648) |
| IUPAC Name |
|---|
| 3'-phosphoadenosine 5'-{3-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-{[3-oxo-3-({2-[(3-oxohexanoyl)sulfanyl]ethyl}amino)propyl]amino}butyl] dihydrogen diphosphate} |
| Synonyms | Source |
|---|---|
| 3-Ketohexanoyl-CoA | KEGG COMPOUND |
| 3-Ketohexanoyl-coenzyme A | ChemIDplus |
| 3-Oxohexanoyl-CoA | KEGG COMPOUND |
| 3-oxohexanoyl-coenzyme A | ChEBI |
| adenosine 3'-phosphoric acid 5'-[diphosphoric acid P2-[2,2-dimethyl-3-hydroxy-3-[[2-[[2-(3-oxohexanoylthio)ethyl]aminocarbonyl]ethyl]aminocarbonyl]propyl]] ester | ChEBI |
| Coenzyme A, S-(3-oxohexanoate) | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C05269 | KEGG COMPOUND |
| HMDB0003943 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:19774-86-8 | KEGG COMPOUND |
| CAS:19774-86-8 | ChemIDplus |
| Citations |
|---|