EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15NO4 |
| Net Charge | 0 |
| Average Mass | 213.233 |
| Monoisotopic Mass | 213.10011 |
| SMILES | CCCC(=O)CC(=O)NC1CCOC1=O |
| InChI | InChI=1S/C10H15NO4/c1-2-3-7(12)6-9(13)11-8-4-5-15-10(8)14/h8H,2-6H2,1H3,(H,11,13) |
| InChIKey | YRYOXRMDHALAFL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | autoinducer A signalling molecule produced and used by bacteria participating in quorum sensing, that is, in cell-cell communication to coordinate community-wide regulation of processes such as biofilm formation, virulence, and bioluminescence in populations of bacteria. Such communication can occur both within and between different species of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(3-oxohexanoyl)homoserine lactone (CHEBI:29640) has functional parent 3-oxohexanoic acid (CHEBI:28422) |
| N-(3-oxohexanoyl)homoserine lactone (CHEBI:29640) is a N-acyl homoserine lactone (CHEBI:83169) |
| N-(3-oxohexanoyl)homoserine lactone (CHEBI:29640) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 3-oxo-N-(2-oxotetrahydrofuran-3-yl)hexanamide |
| Synonyms | Source |
|---|---|
| 3-oxo-C6-AHL | ChEBI |
| 3-oxo-N-(tetrahydro-2-oxo-3-furanyl)hexanamide | ChemIDplus |
| AI-1 (Vibrio fischeri) | MetaCyc |
| AI-1 lactone | ChemIDplus |
| Autoinducer 1 | ChemIDplus |
| N-(3-oxohexanoyl)-3-aminodihydro-2(3H)-furanone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13576940 | Reaxys |
| CAS:76924-95-3 | KEGG COMPOUND |
| CAS:76924-95-3 | ChemIDplus |
| Citations |
|---|