EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:28266 - fluorene
| Formula | C13H10 |
| Net Charge | 0 |
| Average Mass | 166.223 |
| Monoisotopic Mass | 166.07825 |
| SMILES | c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H,9H2 |
| InChIKey | NIHNNTQXNPWCJQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluorene (CHEBI:28266) is a ortho-fused polycyclic arene (CHEBI:35296) |
| fluorene (CHEBI:28266) is a ortho-fused tricyclic hydrocarbon (CHEBI:37089) |
| Incoming Relation(s) |
| 2-nitrofluorene (CHEBI:1224) has functional parent fluorene (CHEBI:28266) |
| 2-acetamidofluorene (CHEBI:17356) has parent hydride fluorene (CHEBI:28266) |
| fluorenes (CHEBI:24059) has parent hydride fluorene (CHEBI:28266) |
| IUPAC Names |
|---|
| 9H-fluorene |
| fluorene |
| Synonyms | Source |
|---|---|
| Fluorene | KEGG COMPOUND |
| Diphenylenemethane | KEGG COMPOUND |
| 2,2'-Methylenebiphenyl | KEGG COMPOUND |
| 2,3-benzindene | ChemIDplus |
| o-biphenylenemethane | NIST Chemistry WebBook |
| Fluoren | ChEBI |
| Citations |
|---|