EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H13NO |
| Net Charge | 0 |
| Average Mass | 223.275 |
| Monoisotopic Mass | 223.09971 |
| SMILES | CC(=O)Nc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C15H13NO/c1-10(17)16-13-6-7-15-12(9-13)8-11-4-2-3-5-14(11)15/h2-7,9H,8H2,1H3,(H,16,17) |
| InChIKey | CZIHNRWJTSTCEX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. antimitotic Any compound that inhibits cell division (mitosis). epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-acetamidofluorene (CHEBI:17356) has parent hydride fluorene (CHEBI:28266) |
| 2-acetamidofluorene (CHEBI:17356) has role antimitotic (CHEBI:64911) |
| 2-acetamidofluorene (CHEBI:17356) has role carcinogenic agent (CHEBI:50903) |
| 2-acetamidofluorene (CHEBI:17356) has role epitope (CHEBI:53000) |
| 2-acetamidofluorene (CHEBI:17356) has role mutagen (CHEBI:25435) |
| 2-acetamidofluorene (CHEBI:17356) is a 2-acetamidofluorenes (CHEBI:19432) |
| Incoming Relation(s) |
| 2-acetamidofluorene N-sulfate (CHEBI:35424) has functional parent 2-acetamidofluorene (CHEBI:17356) |
| IUPAC Name |
|---|
| N-(9H-fluoren-2-yl)acetamide |
| Synonyms | Source |
|---|---|
| 2-AAF | NIST Chemistry WebBook |
| 2-Acetamidofluorene | KEGG COMPOUND |
| 2-Acetaminofluorene | ChemIDplus |
| 2-Acetoaminofluorene | ChemIDplus |
| 2-Acetylaminofluorene | ChemIDplus |
| 2-(Acetylamino)fluorene | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2-acetamidofluorene | UniProt |
| Citations |
|---|