EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H9NO2 |
| Net Charge | 0 |
| Average Mass | 211.220 |
| Monoisotopic Mass | 211.06333 |
| SMILES | O=[N+]([O-])c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H9NO2/c15-14(16)11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8H,7H2 |
| InChIKey | XFOHWECQTFIEIX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-nitrofluorene (CHEBI:1224) has functional parent fluorene (CHEBI:28266) |
| 2-nitrofluorene (CHEBI:1224) has role carcinogenic agent (CHEBI:50903) |
| 2-nitrofluorene (CHEBI:1224) has role mutagen (CHEBI:25435) |
| 2-nitrofluorene (CHEBI:1224) is a nitroarene (CHEBI:51132) |
| IUPAC Name |
|---|
| 2-nitro-9H-fluorene |
| Synonyms | Source |
|---|---|
| 2-Nitrofluorene | KEGG COMPOUND |
| NF | KEGG COMPOUND |
| Nitrofluorene | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2-Nitrofluorene | Wikipedia |
| C10923 | KEGG COMPOUND |
| LSM-37230 | LINCS |
| Citations |
|---|