EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O5 |
| Net Charge | 0 |
| Average Mass | 280.320 |
| Monoisotopic Mass | 280.13107 |
| SMILES | CC(=C/C(=O)O)/C=C/[C@]1(O)[C@@]2(C)CO[C@]1(C)CC(=O)C2 |
| InChI | InChI=1S/C15H20O5/c1-10(6-12(17)18)4-5-15(19)13(2)7-11(16)8-14(15,3)20-9-13/h4-6,19H,7-9H2,1-3H3,(H,17,18)/b5-4+,10-6-/t13-,14-,15+/m1/s1 |
| InChIKey | IZGYIFFQBZWOLJ-UUZREKTLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phaseic acid (CHEBI:28205) has role metabolite (CHEBI:25212) |
| phaseic acid (CHEBI:28205) is a apo carotenoid sesquiterpenoid (CHEBI:36758) |
| phaseic acid (CHEBI:28205) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| phaseic acid (CHEBI:28205) is conjugate acid of phaseic acid anion (CHEBI:62069) |
| Incoming Relation(s) |
| epi-dihydrophaseic acid (CHEBI:23926) has functional parent phaseic acid (CHEBI:28205) |
| dihydrophaseic acid (CHEBI:23757) has functional parent phaseic acid (CHEBI:28205) |
| dihydrophaseic acid 4-O-β-D-glucoside (CHEBI:23758) has functional parent phaseic acid (CHEBI:28205) |
| phaseic acid anion (CHEBI:62069) is conjugate base of phaseic acid (CHEBI:28205) |
| IUPAC Names |
|---|
| (2Z,4E)-5-[(1R,5R,8S)-8-hydroxy-1,5-dimethyl-3-oxo-6-oxabicyclo[3.2.1]oct-8-yl]-3-methylpenta-2,4-dienoic acid |
| (7E,9Z)-(1R,5R,6S)-5,16-epoxy-6-hydroxy-3-oxo-5,6-dihydro-11-apo-β-caroten-11-oic acid |
| Synonyms | Source |
|---|---|
| (−)-Phaseic acid | JCBN |
| Phaseic acid | KEGG COMPOUND |
| Citations |
|---|