EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22O5 |
| Net Charge | 0 |
| Average Mass | 282.336 |
| Monoisotopic Mass | 282.14672 |
| SMILES | CC(=C/C(=O)O)/C=C/[C@]1(O)[C@@]2(C)CO[C@]1(C)C[C@H](O)C2 |
| InChI | InChI=1S/C15H22O5/c1-10(6-12(17)18)4-5-15(19)13(2)7-11(16)8-14(15,3)20-9-13/h4-6,11,16,19H,7-9H2,1-3H3,(H,17,18)/b5-4+,10-6-/t11-,13-,14-,15+/m1/s1 |
| InChIKey | XIVFQYWMMJWUCD-FJBUYRLMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epi-dihydrophaseic acid (CHEBI:23926) has functional parent phaseic acid (CHEBI:28205) |
| epi-dihydrophaseic acid (CHEBI:23926) is a 6-hydroxy monocarboxylic acid (CHEBI:35971) |
| epi-dihydrophaseic acid (CHEBI:23926) is a cyclic ether (CHEBI:37407) |
| epi-dihydrophaseic acid (CHEBI:23926) is a secondary alcohol (CHEBI:35681) |
| epi-dihydrophaseic acid (CHEBI:23926) is a tertiary alcohol (CHEBI:26878) |
| epi-dihydrophaseic acid (CHEBI:23926) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2Z,4E)-5-[(1R,3R,5R,8S)-3,8-dihydroxy-1,5-dimethyl-6-oxabicyclo[3.2.1]oct-8-yl]-3-methylpenta-2,4-dienoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6770422 | Reaxys |