EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24N2O2 |
| Net Charge | 0 |
| Average Mass | 264.369 |
| Monoisotopic Mass | 264.18378 |
| SMILES | [H][C@@]12CN3C(=O)CCC[C@]3([H])[C@@]([H])(C1)C(O)N1CCCC[C@]12[H] |
| InChI | InChI=1S/C15H24N2O2/c18-14-6-3-5-13-11-8-10(9-17(13)14)12-4-1-2-7-16(12)15(11)19/h10-13,15,19H,1-9H2/t10-,11+,12-,13+,15?/m0/s1 |
| InChIKey | LCORZQTZVFOPGT-IZADBBIGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17-hydroxylupanine (CHEBI:64287) has functional parent lupanine (CHEBI:28193) |
| 17-hydroxylupanine (CHEBI:64287) is a hemiaminal (CHEBI:73080) |
| 17-hydroxylupanine (CHEBI:64287) is a quinolizidine alkaloid (CHEBI:26515) |
| 17-hydroxylupanine (CHEBI:64287) is conjugate base of 17-hydroxylupanine(1+) (CHEBI:64262) |
| Incoming Relation(s) |
| 17-hydroxylupanine(1+) (CHEBI:64262) is conjugate acid of 17-hydroxylupanine (CHEBI:64287) |
| IUPAC Name |
|---|
| 17-hydroxyspartein-2-one |
| Manual Xrefs | Databases |
|---|---|
| CPD-13928 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5959682 | Reaxys |
| CAS:15043-17-1 | ChemIDplus |
| Citations |
|---|