EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33O6 |
| Net Charge | -1 |
| Average Mass | 369.478 |
| Monoisotopic Mass | 369.22826 |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](CC(=O)CCCCC(=O)[O-])[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H34O6/c1-2-3-4-7-14(21)10-11-16-17(19(24)13-18(16)23)12-15(22)8-5-6-9-20(25)26/h10-11,14,16-19,21,23-24H,2-9,12-13H2,1H3,(H,25,26)/p-1/b11-10+/t14-,16+,17+,18+,19-/m0/s1 |
| InChIKey | KFGOFTHODYBSGM-ZUNNJUQCSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-oxoprostaglandin F1α(1−) (CHEBI:133451) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| 6-oxoprostaglandin F1α(1−) (CHEBI:133451) is conjugate base of 6-oxoprostaglandin F1α (CHEBI:28158) |
| Incoming Relation(s) |
| 6-oxoprostaglandin F1α (CHEBI:28158) is conjugate acid of 6-oxoprostaglandin F1α(1−) (CHEBI:133451) |
| Synonyms | Source |
|---|---|
| 6-oxo-prostaglandin F1α(1−) | ChEBI |
| 6-oxo-PGF1α(1−) | ChEBI |