EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O |
| Net Charge | 0 |
| Average Mass | 122.167 |
| Monoisotopic Mass | 122.07316 |
| SMILES | COc1ccccc1C |
| InChI | InChI=1S/C8H10O/c1-7-5-3-4-6-8(7)9-2/h3-6H,1-2H3 |
| InChIKey | DTFKRVXLBCAIOZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. polar aprotic solvent A solvent with a comparatively high relative permittivity (or dielectric constant), greater than ca. 15, and a sizable permanent dipole moment, that cannot donate suitably labile hydrogen atoms to form strong hydrogen bonds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylanisole (CHEBI:141702) has functional parent o-cresol (CHEBI:28054) |
| 2-methylanisole (CHEBI:141702) has role flavouring agent (CHEBI:35617) |
| 2-methylanisole (CHEBI:141702) has role polar aprotic solvent (CHEBI:48358) |
| 2-methylanisole (CHEBI:141702) is a monomethoxybenzene (CHEBI:25235) |
| 2-methylanisole (CHEBI:141702) is a toluenes (CHEBI:27024) |
| 2-methylanisole (CHEBI:141702) is a volatile organic compound (CHEBI:134179) |
| IUPAC Name |
|---|
| 1-methoxy-2-methylbenzene |
| Synonyms | Source |
|---|---|
| 2-methoxytoluene | ChemIDplus |
| 2-methylmethoxybenzene | ChemIDplus |
| o-cresol methyl ether | ChemIDplus |
| o-cresyl methyl ether | ChemIDplus |
| o-methoxytoluene | ChEBI |
| o-methylanisole | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 2-methylanisole | UniProt |
| Manual Xrefs | Databases |
|---|---|
| FDB008787 | FooDB |
| HMDB0032074 | HMDB |
| Methoxytoluene | Wikipedia |
| Citations |
|---|