EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N4O3 |
| Net Charge | 0 |
| Average Mass | 240.263 |
| Monoisotopic Mass | 240.12224 |
| SMILES | NCCCC(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C10H16N4O3/c11-3-1-2-9(15)14-8(10(16)17)4-7-5-12-6-13-7/h5-6,8H,1-4,11H2,(H,12,13)(H,14,15)(H,16,17)/t8-/m0/s1 |
| InChIKey | CCLQKVKJOGVQLU-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-homocarnosine (CHEBI:85981) has role human metabolite (CHEBI:77746) |
| L-homocarnosine (CHEBI:85981) is a N-acyl-L-α-amino acid (CHEBI:48927) |
| L-homocarnosine (CHEBI:85981) is a L-histidine derivative (CHEBI:84076) |
| L-homocarnosine (CHEBI:85981) is a dipeptide (CHEBI:46761) |
| L-homocarnosine (CHEBI:85981) is a homocarnosine (CHEBI:28050) |
| L-homocarnosine (CHEBI:85981) is tautomer of L-homocarnosine zwitterion (CHEBI:143075) |
| Incoming Relation(s) |
| L-homocarnosine zwitterion (CHEBI:143075) is tautomer of L-homocarnosine (CHEBI:85981) |
| IUPAC Name |
|---|
| N-(4-aminobutanoyl)-L-histidine |
| Synonyms | Source |
|---|---|
| (2S)-homocarnosine | ChEBI |
| N-(4-aminobutanoyl)-(S)-histidine | ChEBI |
| N-(4-aminobutyryl)-L-histidine | ChEBI |
| Nα-(4-aminobutyryl)-L-histidine | ChEBI |
| homocarnosine | ChEBI |
| (S)-homocarnosine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00884 | KEGG COMPOUND |
| CPD-12185 | MetaCyc |
| HMDB0000745 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24662 | Reaxys |
| CAS:3650-73-5 | KEGG COMPOUND |
| CAS:3650-73-5 | ChemIDplus |
| Citations |
|---|