EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O6 |
| Net Charge | 0 |
| Average Mass | 174.108 |
| Monoisotopic Mass | 174.01644 |
| SMILES | [H][C@]1([C@@H](O)CO)OC(=O)C(=O)C1=O |
| InChI | InChI=1S/C6H6O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-8H,1H2/t2-,5+/m0/s1 |
| InChIKey | SBJKKFFYIZUCET-JLAZNSOCSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | coenzyme A low-molecular-weight, non-protein organic compound participating in enzymatic reactions as dissociable acceptor or donor of chemical groups or electrons. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-dehydroascorbic acid (CHEBI:27956) has functional parent L-ascorbic acid (CHEBI:29073) |
| L-dehydroascorbic acid (CHEBI:27956) has role coenzyme (CHEBI:23354) |
| L-dehydroascorbic acid (CHEBI:27956) has role mouse metabolite (CHEBI:75771) |
| L-dehydroascorbic acid (CHEBI:27956) is a dehydroascorbic acid (CHEBI:17242) |
| L-dehydroascorbic acid (CHEBI:27956) is a vitamin C (CHEBI:176783) |
| L-dehydroascorbic acid (CHEBI:27956) is conjugate acid of L-dehydroascorbate (CHEBI:58539) |
| Incoming Relation(s) |
| L-dehydroascorbic acid hydrate (CHEBI:178008) has part L-dehydroascorbic acid (CHEBI:27956) |
| L-dehydroascorbate (CHEBI:58539) is conjugate base of L-dehydroascorbic acid (CHEBI:27956) |
| IUPAC Name |
|---|
| (5R)-5-[(1S)-1,2-dihydroxyethyl]furan-2,3,4(5H)-trione |
| Synonyms | Source |
|---|---|
| dehydroascorbic acid | ChemIDplus |
| Dehydroascorbic acid | KEGG COMPOUND |
| dehydro-L-ascorbic acid | ChemIDplus |
| DHAA | ChemIDplus |
| L-Dehydroascorbate | KEGG COMPOUND |
| L-Dehydroascorbate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00007380 | KNApSAcK |
| C05422 | KEGG COMPOUND |
| Dehydroascorbic_acid | Wikipedia |
| HMDB0001264 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Gmelin:51038 | Gmelin |
| Reaxys:84277 | Reaxys |
| CAS:490-83-5 | ChemIDplus |
| CAS:490-83-5 | KEGG COMPOUND |
| Citations |
|---|