EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O6.H2O |
| Net Charge | 0 |
| Average Mass | 192.123 |
| Monoisotopic Mass | 192.02700 |
| SMILES | O.[H][C@]1([C@@H](O)CO)OC(=O)C(=O)C1=O |
| InChI | InChI=1S/C6H6O6.H2O/c7-1-2(8)5-3(9)4(10)6(11)12-5;/h2,5,7-8H,1H2;1H2/t2-,5+;/m0./s1 |
| InChIKey | XGEACXUVJVLYDD-RXSVEWSESA-N |
| Roles Classification |
|---|
| Biological Role: | water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-dehydroascorbic acid hydrate (CHEBI:178008) has part L-dehydroascorbic acid (CHEBI:27956) |
| L-dehydroascorbic acid hydrate (CHEBI:178008) is a hydrate (CHEBI:35505) |
| L-dehydroascorbic acid hydrate (CHEBI:178008) is a vitamin C (CHEBI:176783) |
| IUPAC Name |
|---|
| (5R)-5-[(1S)-1,2-dihydroxyethyl]furan-2,3,4(5H)-trione—water (1/1) |
| Synonyms | Source |
|---|---|
| (5R)-5-[(1S)-1,2-dihydroxyethyl]furan-2,3,4(5H)-trione hydrate | IUPAC |
| dehydroascorbic acid hydrate | ChEBI |
| oxidized ascorbic acid hydrate | ChEBI |
| oxidized vitamin C hydrate | ChEBI |
| L-dehydroascorbic acid monohydrate | ChEBI |
| Citations |
|---|