EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5O6 |
| Net Charge | -1 |
| Average Mass | 173.100 |
| Monoisotopic Mass | 173.00916 |
| SMILES | O=C1O[C-]([C@@H](O)CO)C(=O)C1=O |
| InChI | InChI=1S/C6H5O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,7-8H,1H2/q-1/t2-/m0/s1 |
| InChIKey | OESHPIGALOBJLM-REOHCLBHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-dehydroascorbate (CHEBI:58539) is a organic anion (CHEBI:25696) |
| L-dehydroascorbate (CHEBI:58539) is conjugate base of L-dehydroascorbic acid (CHEBI:27956) |
| Incoming Relation(s) |
| L-dehydroascorbic acid (CHEBI:27956) is conjugate acid of L-dehydroascorbate (CHEBI:58539) |
| IUPAC Name |
|---|
| 2-[(1S)-1,2-dihydroxyethyl]-3,4,5-trioxotetrahydrofuran-2-ide |
| Synonyms | Source |
|---|---|
| dehydroascorbate | ChEBI |
| dehydro-L-ascorbate | ChEBI |
| L-dehydroascorbate anion | ChEBI |
| L-dehydroascorbic acid(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| L-dehydroascorbate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5562275 | Reaxys |
| Citations |
|---|