EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19NO3 |
| Net Charge | 0 |
| Average Mass | 273.332 |
| Monoisotopic Mass | 273.13649 |
| SMILES | CO[C@H]1C=CC2=CCN3CCC4=C(CC(=O)OC4)[C@]23C1 |
| InChI | InChI=1S/C16H19NO3/c1-19-13-3-2-12-5-7-17-6-4-11-10-20-15(18)8-14(11)16(12,17)9-13/h2-3,5,13H,4,6-10H2,1H3/t13-,16-/m0/s1 |
| InChIKey | PXWINCSLFXUWBZ-BBRMVZONSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | muscle relaxant A drug used to produce muscle relaxation (excepting neuromuscular blocking agents). Its primary clinical and therapeutic use is the treatment of muscle spasm and immobility associated with strains, sprains, and injuries of the back and, to a lesser degree, injuries to the neck. Also used for the treatment of a variety of clinical conditions that have in common only the presence of skeletal muscle hyperactivity, for example, the muscle spasms that can occur in multiple sclerosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-erythroidine (CHEBI:27795) has role muscle relaxant (CHEBI:51371) |
| β-erythroidine (CHEBI:27795) has role plant metabolite (CHEBI:76924) |
| β-erythroidine (CHEBI:27795) is a indole alkaloid (CHEBI:38958) |
| β-erythroidine (CHEBI:27795) is a organic heterotetracyclic compound (CHEBI:38163) |
| β-erythroidine (CHEBI:27795) is a tertiary amino compound (CHEBI:50996) |
| β-erythroidine (CHEBI:27795) is a δ-lactone (CHEBI:18946) |
| Incoming Relation(s) |
| dihydro-β-erythroidine (CHEBI:34705) has functional parent β-erythroidine (CHEBI:27795) |
| IUPAC Name |
|---|
| (4bS,6R)-6-methoxy-1,4,6,10,12,13-hexahydro-3H,5H-pyrano[4',3':3,4]pyrido[2,1-i]indol-3-one |
| Synonyms | Source |
|---|---|
| 12,13-didehydro-13,14-dihydro-α-erythroidine | ChemIDplus |
| (+)-β-erythroidine | ChEBI |
| Citations |
|---|