EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21NO3 |
| Net Charge | 0 |
| Average Mass | 275.348 |
| Monoisotopic Mass | 275.15214 |
| SMILES | CO[C@H]1CC=C2CCN3CCC4=C(CC(=O)OC4)[C@]23C1 |
| InChI | InChI=1S/C16H21NO3/c1-19-13-3-2-12-5-7-17-6-4-11-10-20-15(18)8-14(11)16(12,17)9-13/h2,13H,3-10H2,1H3/t13-,16-/m0/s1 |
| InChIKey | ALSKYCOJJPXPFS-BBRMVZONSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. |
| Application: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dihydro-β-erythroidine (CHEBI:34705) has functional parent β-erythroidine (CHEBI:27795) |
| dihydro-β-erythroidine (CHEBI:34705) has role nicotinic antagonist (CHEBI:48878) |
| dihydro-β-erythroidine (CHEBI:34705) is a organic heterotetracyclic compound (CHEBI:38163) |
| dihydro-β-erythroidine (CHEBI:34705) is a tertiary amino compound (CHEBI:50996) |
| dihydro-β-erythroidine (CHEBI:34705) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (4bS,6S)-6-methoxy-1,4,6,7,9,10,12,13-octahydro-3H,5H-pyrano[4',3':3,4]pyrido[2,1-i]indol-3-one |
| Synonyms | Source |
|---|---|
| 3β-methoxy-14,17-dihydro-16-oxa-erythrin-1(6)-en-15-one | ChEBI |
| DHβE | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C13682 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:36193 | Reaxys |
| CAS:23255-54-1 | KEGG COMPOUND |
| CAS:23255-54-1 | ChemIDplus |
| Citations |
|---|