EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9O5 |
| Net Charge | -1 |
| Average Mass | 197.166 |
| Monoisotopic Mass | 197.04555 |
| SMILES | COc1cc(C(O)C(=O)[O-])ccc1O |
| InChI | InChI=1S/C9H10O5/c1-14-7-4-5(2-3-6(7)10)8(11)9(12)13/h2-4,8,10-11H,1H3,(H,12,13)/p-1 |
| InChIKey | CGQCWMIAEPEHNQ-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vanillylmandelate (CHEBI:27622) has functional parent mandelate (CHEBI:25147) |
| vanillylmandelate (CHEBI:27622) has role human metabolite (CHEBI:77746) |
| vanillylmandelate (CHEBI:27622) is a hydroxy monocarboxylic acid anion (CHEBI:36059) |
| vanillylmandelate (CHEBI:27622) is conjugate base of vanillylmandelic acid (CHEBI:20106) |
| Incoming Relation(s) |
| vanillylmandelic acid (CHEBI:20106) is conjugate acid of vanillylmandelate (CHEBI:27622) |
| IUPAC Name |
|---|
| 2-hydroxy-2-(4-hydroxy-3-methoxyphenyl)acetate |
| Synonyms | Source |
|---|---|
| 3-Methoxy-4-hydroxymandelate | KEGG COMPOUND |
| vanilmandelate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C05584 | KEGG COMPOUND |