EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O5 |
| Net Charge | 0 |
| Average Mass | 198.174 |
| Monoisotopic Mass | 198.05282 |
| SMILES | COc1cc(C(O)C(=O)O)ccc1O |
| InChI | InChI=1S/C9H10O5/c1-14-7-4-5(2-3-6(7)10)8(11)9(12)13/h2-4,8,10-11H,1H3,(H,12,13) |
| InChIKey | CGQCWMIAEPEHNQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vanillylmandelic acid (CHEBI:20106) has functional parent mandelic acid (CHEBI:35825) |
| vanillylmandelic acid (CHEBI:20106) has role human metabolite (CHEBI:77746) |
| vanillylmandelic acid (CHEBI:20106) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| vanillylmandelic acid (CHEBI:20106) is a aromatic ether (CHEBI:35618) |
| vanillylmandelic acid (CHEBI:20106) is a phenols (CHEBI:33853) |
| vanillylmandelic acid (CHEBI:20106) is conjugate acid of vanillylmandelate (CHEBI:27622) |
| Incoming Relation(s) |
| vanillylmandelate (CHEBI:27622) is conjugate base of vanillylmandelic acid (CHEBI:20106) |
| IUPAC Name |
|---|
| 2-hydroxy-2-(4-hydroxy-3-methoxyphenyl)acetic acid |
| Synonyms | Source |
|---|---|
| 3-methoxy-4-hydroxymandelic acid | ChEBI |
| hydroxy(4-hydroxy-3-methoxyphenyl)acetic acid | IUPAC |
| Vanillylmandelic acid | KEGG COMPOUND |
| Vanilmandelic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C05584 | KEGG COMPOUND |
| HMDB0000291 | HMDB |
| VANILLYL_MANDELATE | MetaCyc |
| Vanillylmandelic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2213227 | Reaxys |
| CAS:55-10-7 | KEGG COMPOUND |
| CAS:55-10-7 | ChemIDplus |
| Citations |
|---|