EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10NO2 |
| Net Charge | -1 |
| Average Mass | 116.140 |
| Monoisotopic Mass | 116.07170 |
| SMILES | CC(C)[C@@H](N)C(=O)[O-] |
| InChI | InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/p-1/t4-/m1/s1 |
| InChIKey | KZSNJWFQEVHDMF-SCSAIBSYSA-M |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-valinate (CHEBI:32855) has role plant metabolite (CHEBI:76924) |
| D-valinate (CHEBI:32855) is a valinate (CHEBI:32859) |
| D-valinate (CHEBI:32855) is conjugate base of D-valine (CHEBI:27477) |
| D-valinate (CHEBI:32855) is enantiomer of L-valinate (CHEBI:32851) |
| Incoming Relation(s) |
| D-valine (CHEBI:27477) is conjugate acid of D-valinate (CHEBI:32855) |
| L-valinate (CHEBI:32851) is enantiomer of D-valinate (CHEBI:32855) |
| IUPAC Name |
|---|
| D-valinate |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-3-methylbutanoate | IUPAC |
| D-valine anion | JCBN |
| Registry Numbers | Sources |
|---|---|
| Gmelin:325408 | Gmelin |