EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14O6 |
| Net Charge | 0 |
| Average Mass | 194.183 |
| Monoisotopic Mass | 194.07904 |
| SMILES | CO[C@H]1[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H14O6/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h2-12H,1H3/t2-,3-,4-,5+,6+,7-/m1/s1 |
| InChIKey | DSCFFEYYQKSRSV-NYLBLOMBSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1D-5-O-methyl-chiro-inositol (CHEBI:18173) has functional parent 1D-chiro-inositol (CHEBI:27372) |
| 1D-5-O-methyl-chiro-inositol (CHEBI:18173) has role plant metabolite (CHEBI:76924) |
| 1D-5-O-methyl-chiro-inositol (CHEBI:18173) is a cyclitol ether (CHEBI:61362) |
| IUPAC Name |
|---|
| 1D-5-O-methyl-chiro-inositol |
| Synonyms | Source |
|---|---|
| (1S,2R,3R,4R,5S,6S)-6-methoxycyclohexane-1,2,3,4,5-pentol | IUPAC |
| 1D-(1,2,4/3,5,6)-5-O-methylcyclohexanehexol | IUPAC |
| 5-O-methyl-1D-chiro-inositol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 20120106 | ChemSpider |
| HMDB0062564 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4291950 | Reaxys |
| CAS:152203-10-6 | ChEBI |