EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O |
| Net Charge | 0 |
| Average Mass | 148.205 |
| Monoisotopic Mass | 148.08882 |
| SMILES | [H]C(C)=Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C10H12O/c1-3-4-9-5-7-10(11-2)8-6-9/h3-8H,1-2H3 |
| InChIKey | RUVINXPYWBROJD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anethole (CHEBI:2716) has role plant metabolite (CHEBI:76924) |
| anethole (CHEBI:2716) is a monomethoxybenzene (CHEBI:25235) |
| Incoming Relation(s) |
| cis-anethole (CHEBI:78412) is a anethole (CHEBI:2716) |
| trans-anethole (CHEBI:35616) is a anethole (CHEBI:2716) |
| IUPAC Name |
|---|
| 1-methoxy-4-(prop-1-en-1-yl)benzene |
| Synonyms | Source |
|---|---|
| methyl 4-(prop-1-en-1-yl)phenyl ether | IUPAC |
| p-propenylanisole | ChEBI |
| Citations |
|---|