EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O |
| Net Charge | 0 |
| Average Mass | 148.205 |
| Monoisotopic Mass | 148.08882 |
| SMILES | C/C=C\c1ccc(OC)cc1 |
| InChI | InChI=1S/C10H12O/c1-3-4-9-5-7-10(11-2)8-6-9/h3-8H,1-2H3/b4-3- |
| InChIKey | RUVINXPYWBROJD-ARJAWSKDSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-anethole (CHEBI:78412) is a anethole (CHEBI:2716) |
| IUPAC Name |
|---|
| methyl 4-[(1Z)-prop-1-en-1-yl]phenyl ether |
| Synonym | Source |
|---|---|
| 1-methoxy-4-[(1Z)-prop-1-en-1-yl]benzene | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1209632 | Reaxys |
| CAS:25679-28-1 | ChemIDplus |