EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O |
| Net Charge | 0 |
| Average Mass | 148.205 |
| Monoisotopic Mass | 148.08882 |
| SMILES | C/C=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C10H12O/c1-3-4-9-5-7-10(11-2)8-6-9/h3-8H,1-2H3/b4-3+ |
| InChIKey | RUVINXPYWBROJD-ONEGZZNKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | flavouring agent A food additive that is used to added improve the taste or odour of a food. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-anethole (CHEBI:35616) has role flavouring agent (CHEBI:35617) |
| trans-anethole (CHEBI:35616) is a anethole (CHEBI:2716) |
| IUPAC Name |
|---|
| 1-methoxy-4-[(1E)-prop-1-en-1-yl]benzene |
| Synonyms | Source |
|---|---|
| Anethole | ChemIDplus |
| (E)-1-(4-Methoxyphenyl)propene | ChemIDplus |
| (E)-1-Methoxy-4-(1-propenyl)benzene | ChemIDplus |
| (E)-p-Propenylanisole | ChemIDplus |
| (E)-Anethole | ChemIDplus |
| trans-4-(1-Propenyl)anisole | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (E)-anethole | UniProt |