EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15884 - tropine
| Formula | C8H15NO |
| Net Charge | 0 |
| Average Mass | 141.214 |
| Monoisotopic Mass | 141.11536 |
| SMILES | CN1[C@@H]2CC[C@H]1C[C@@H](O)C2 |
| InChI | InChI=1S/C8H15NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-8,10H,2-5H2,1H3/t6-,7+,8+ |
| InChIKey | CYHOMWAPJJPNMW-JIGDXULJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tropine (CHEBI:15884) has role mouse metabolite (CHEBI:75771) |
| tropine (CHEBI:15884) is a tropane alkaloid (CHEBI:37332) |
| tropine (CHEBI:15884) is conjugate base of tropinium (CHEBI:57554) |
| Incoming Relation(s) |
| O-acyltropine (CHEBI:52656) has functional parent tropine (CHEBI:15884) |
| deptropine (CHEBI:50189) has functional parent tropine (CHEBI:15884) |
| tropan-3α-yl 3-hydroxy-2-phenylpropanoate (CHEBI:78734) has functional parent tropine (CHEBI:15884) |
| tropanyl 3,5-dimethylbenzoate (CHEBI:64142) has functional parent tropine (CHEBI:15884) |
| tropisetron (CHEBI:32269) has functional parent tropine (CHEBI:15884) |
| tropinium (CHEBI:57554) is conjugate acid of tropine (CHEBI:15884) |
| IUPAC Name |
|---|
| tropan-3α-ol |
| Synonyms | Source |
|---|---|
| Tropine | KEGG COMPOUND |
| 3alpha-Tropanol | KEGG COMPOUND |
| 8-methyl-8-azabicyclo[3.2.1]octan-3-ol | NIST Chemistry WebBook |
| 1αH,5αH-tropan-3α-ol | NIST Chemistry WebBook |
| 3α-tropanol | NIST Chemistry WebBook |
| (3-endo)-8-methyl-8-azabicyclo[3.2.1]octan-3-ol | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C00729 | KEGG COMPOUND |
| US2010087364 | Patent |
| CN101643472 | Patent |
| CN101643473 | Patent |
| C00002306 | KNApSAcK |
| Citations |
|---|