EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23NO2 |
| Net Charge | 0 |
| Average Mass | 273.376 |
| Monoisotopic Mass | 273.17288 |
| SMILES | Cc1cc(C)cc(C(=O)O[C@H]2C[C@H]3CC[C@@H](C2)N3C)c1 |
| InChI | InChI=1S/C17H23NO2/c1-11-6-12(2)8-13(7-11)17(19)20-16-9-14-4-5-15(10-16)18(14)3/h6-8,14-16H,4-5,9-10H2,1-3H3/t14-,15+,16+ |
| InChIKey | HDDNYFLPWFSBLN-ZSHCYNCHSA-N |
| Roles Classification |
|---|
| Biological Roles: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tropanyl 3,5-dimethylbenzoate (CHEBI:64142) has functional parent tropine (CHEBI:15884) |
| tropanyl 3,5-dimethylbenzoate (CHEBI:64142) has role serotonergic antagonist (CHEBI:48279) |
| tropanyl 3,5-dimethylbenzoate (CHEBI:64142) is a benzoate ester (CHEBI:36054) |
| tropanyl 3,5-dimethylbenzoate (CHEBI:64142) is a tropane alkaloid (CHEBI:37332) |
| IUPAC Name |
|---|
| (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl 3,5-dimethylbenzoate |
| INNs | Source |
|---|---|
| tropanserin | ChemIDplus |
| tropanserina | ChemIDplus |
| tropanserine | ChemIDplus |
| tropanserinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| MDL 72222 | ChEBI |
| Tropyl 3,5-dimethylbenzoate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21043097 | Reaxys |
| CAS:85181-40-4 | ChemIDplus |
| Citations |
|---|