EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50189 - deptropine
| Formula | C23H27NO |
| Net Charge | 0 |
| Average Mass | 333.475 |
| Monoisotopic Mass | 333.20926 |
| SMILES | CN1[C@@H]2CC[C@H]1C[C@@H](OC1c3ccccc3CCc3ccccc31)C2 |
| InChI | InChI=1S/C23H27NO/c1-24-18-12-13-19(24)15-20(14-18)25-23-21-8-4-2-6-16(21)10-11-17-7-3-5-9-22(17)23/h2-9,18-20,23H,10-15H2,1H3/t18-,19+,20+ |
| InChIKey | ZWPODSUQWXAZNC-PMOLBWCYSA-N |
| Roles Classification |
|---|
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deptropine (CHEBI:50189) has functional parent tropine (CHEBI:15884) |
| deptropine (CHEBI:50189) has role H1-receptor antagonist (CHEBI:37955) |
| deptropine (CHEBI:50189) has role muscarinic antagonist (CHEBI:48876) |
| deptropine (CHEBI:50189) has role parasympatholytic (CHEBI:50370) |
| deptropine (CHEBI:50189) is a azabicycloalkane (CHEBI:38295) |
| deptropine (CHEBI:50189) is a ether (CHEBI:25698) |
| Incoming Relation(s) |
| deptropine citrate (CHEBI:50190) has part deptropine (CHEBI:50189) |
| IUPAC Name |
|---|
| (3-endo)-3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-yloxy)-8-methyl-8-azabicyclo[3.2.1]octane |
| INNs | Source |
|---|---|
| deptropine | ChemIDplus |
| deptropina | ChemIDplus |
| deptropinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| endo-3-[(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-yl)oxy]-8-methyl-8-azabicyclo[3.2.1]octane | ChEBI |
| endo-3-[(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-yl)oxy]-1αH,5αH-tropane | ChEBI |
| dibenzheptropine | ChemIDplus |