EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:50189 - deptropine
| Formula | C23H27NO |
| Net Charge | 0 |
| Average Mass | 333.475 |
| Monoisotopic Mass | 333.20926 |
| SMILES | CN1[C@@H]2CC[C@H]1C[C@@H](OC1c3ccccc3CCc3ccccc31)C2 |
| InChI | InChI=1S/C23H27NO/c1-24-18-12-13-19(24)15-20(14-18)25-23-21-8-4-2-6-16(21)10-11-17-7-3-5-9-22(17)23/h2-9,18-20,23H,10-15H2,1H3/t18-,19+,20+ |
| InChIKey | ZWPODSUQWXAZNC-PMOLBWCYSA-N |
| Roles Classification |
|---|
| Biological Roles: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deptropine (CHEBI:50189) has functional parent tropine (CHEBI:15884) |
| deptropine (CHEBI:50189) has role H1-receptor antagonist (CHEBI:37955) |
| deptropine (CHEBI:50189) has role muscarinic antagonist (CHEBI:48876) |
| deptropine (CHEBI:50189) has role parasympatholytic (CHEBI:50370) |
| deptropine (CHEBI:50189) is a azabicycloalkane (CHEBI:38295) |
| deptropine (CHEBI:50189) is a ether (CHEBI:25698) |
| Incoming Relation(s) |
| deptropine citrate (CHEBI:50190) has part deptropine (CHEBI:50189) |
| IUPAC Name |
|---|
| (3-endo)-3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-yloxy)-8-methyl-8-azabicyclo[3.2.1]octane |
| INNs | Source |
|---|---|
| deptropina | ChemIDplus |
| deptropine | ChemIDplus |
| deptropinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| dibenzheptropine | ChemIDplus |
| endo-3-[(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-yl)oxy]-1αH,5αH-tropane | ChEBI |
| endo-3-[(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-yl)oxy]-8-methyl-8-azabicyclo[3.2.1]octane | ChEBI |