EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25ClN2O5 |
| Net Charge | 0 |
| Average Mass | 408.882 |
| Monoisotopic Mass | 408.14520 |
| SMILES | CCOC(=O)C1=C(COCCN)NC(C)=C(C(=O)OC)C1c1ccccc1Cl |
| InChI | InChI=1S/C20H25ClN2O5/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21/h5-8,17,23H,4,9-11,22H2,1-3H3 |
| InChIKey | HTIQEAQVCYTUBX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiatherosclerotic agent A cardiovascular drug that prevents atherosclerosis (a disease in which the inside of an artery narrows due to the build up of plaque). Compare with antiatherogenic agent. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. vasodilator agent A drug used to cause dilation of the blood vessels. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. renoprotective agent Any compound that is able to prevent damage to the kidneys. hypoglycemic agent A drug which lowers the blood glucose level. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anticholesteremic drug A substance used to lower plasma cholesterol levels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amlodipine (CHEBI:2668) has role anti-HIV agent (CHEBI:64946) |
| amlodipine (CHEBI:2668) has role antiatherosclerotic agent (CHEBI:145947) |
| amlodipine (CHEBI:2668) has role anticholesteremic drug (CHEBI:35821) |
| amlodipine (CHEBI:2668) has role antidepressant (CHEBI:35469) |
| amlodipine (CHEBI:2668) has role antihypertensive agent (CHEBI:35674) |
| amlodipine (CHEBI:2668) has role antineoplastic agent (CHEBI:35610) |
| amlodipine (CHEBI:2668) has role calcium channel blocker (CHEBI:38215) |
| amlodipine (CHEBI:2668) has role cardiovascular drug (CHEBI:35554) |
| amlodipine (CHEBI:2668) has role hypoglycemic agent (CHEBI:35526) |
| amlodipine (CHEBI:2668) has role renoprotective agent (CHEBI:231911) |
| amlodipine (CHEBI:2668) has role vasodilator agent (CHEBI:35620) |
| amlodipine (CHEBI:2668) is a dihydropyridine (CHEBI:50075) |
| amlodipine (CHEBI:2668) is a ethyl ester (CHEBI:23990) |
| amlodipine (CHEBI:2668) is a methyl ester (CHEBI:25248) |
| amlodipine (CHEBI:2668) is a monochlorobenzenes (CHEBI:83403) |
| amlodipine (CHEBI:2668) is a primary amino compound (CHEBI:50994) |
| Incoming Relation(s) |
| amlodipine benzenesulfonate (CHEBI:2669) has part amlodipine (CHEBI:2668) |
| (R)-amlodipine (CHEBI:53795) is a amlodipine (CHEBI:2668) |
| (S)-amlodipine (CHEBI:53796) is a amlodipine (CHEBI:2668) |
| IUPAC Name |
|---|
| 3-ethyl 5-methyl 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| INNs | Source |
|---|---|
| amlodipine | ChEBI |
| amlodipine | KEGG DRUG |
| amlodipino | DrugBank |
| amlodipinum | DrugBank |
| Synonyms | Source |
|---|---|
| 3-Ethyl-5-methyl (±)-2-(2-aminoethoxymethyl)-4-(o-chlorophenyl)-1,4-dihydro-6-methyl-3,5-pyridinedicarboxylate | ChemIDplus |
| AMLODIPINE COMPONENT OF CKD-330 | ChEMBL |
| Amlodipine Free Base | DrugBank |
| HGP-0904 | ChEMBL |
| HGP0904 | ChEMBL |
| Brand Names | Source |
|---|---|
| Astudal 5 | ChEMBL |
| Istin | ChEMBL |
| Norvas | ChEMBL |
| Norvasc | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3570229 | Reaxys |
| CAS:88150-42-9 | DrugBank |
| CAS:88150-42-9 | KEGG COMPOUND |
| CAS:88150-42-9 | KEGG DRUG |
| CAS:88150-42-9 | ChemIDplus |
| Citations |
|---|