EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25ClN2O5 |
| Net Charge | 0 |
| Average Mass | 408.882 |
| Monoisotopic Mass | 408.14520 |
| SMILES | CCOC(=O)C1=C(COCCN)NC(C)=C(C(=O)OC)C1c1ccccc1Cl |
| InChI | InChI=1S/C20H25ClN2O5/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21/h5-8,17,23H,4,9-11,22H2,1-3H3 |
| InChIKey | HTIQEAQVCYTUBX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amlodipine (CHEBI:2668) has role antihypertensive agent (CHEBI:35674) |
| amlodipine (CHEBI:2668) has role calcium channel blocker (CHEBI:38215) |
| amlodipine (CHEBI:2668) has role vasodilator agent (CHEBI:35620) |
| amlodipine (CHEBI:2668) is a dihydropyridine (CHEBI:50075) |
| amlodipine (CHEBI:2668) is a ethyl ester (CHEBI:23990) |
| amlodipine (CHEBI:2668) is a methyl ester (CHEBI:25248) |
| amlodipine (CHEBI:2668) is a monochlorobenzenes (CHEBI:83403) |
| amlodipine (CHEBI:2668) is a primary amino compound (CHEBI:50994) |
| Incoming Relation(s) |
| amlodipine benzenesulfonate (CHEBI:2669) has part amlodipine (CHEBI:2668) |
| (R)-amlodipine (CHEBI:53795) is a amlodipine (CHEBI:2668) |
| (S)-amlodipine (CHEBI:53796) is a amlodipine (CHEBI:2668) |
| IUPAC Name |
|---|
| 3-ethyl 5-methyl 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| INNs | Source |
|---|---|
| amlodipine | KEGG DRUG |
| amlodipine | ChEBI |
| amlodipino | DrugBank |
| amlodipinum | DrugBank |
| Synonyms | Source |
|---|---|
| 3-Ethyl-5-methyl (±)-2-(2-aminoethoxymethyl)-4-(o-chlorophenyl)-1,4-dihydro-6-methyl-3,5-pyridinedicarboxylate | ChemIDplus |
| Amlodipine Free Base | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3570229 | Reaxys |
| CAS:88150-42-9 | DrugBank |
| CAS:88150-42-9 | KEGG COMPOUND |
| CAS:88150-42-9 | ChemIDplus |
| CAS:88150-42-9 | KEGG DRUG |
| Citations |
|---|