EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25ClN2O5 |
| Net Charge | 0 |
| Average Mass | 408.882 |
| Monoisotopic Mass | 408.14520 |
| SMILES | CCOC(=O)C1=C(COCCN)NC(C)=C(C(=O)OC)[C@@H]1c1ccccc1Cl |
| InChI | InChI=1S/C20H25ClN2O5/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21/h5-8,17,23H,4,9-11,22H2,1-3H3/t17-/m0/s1 |
| InChIKey | HTIQEAQVCYTUBX-KRWDZBQOSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-amlodipine (CHEBI:53796) is a amlodipine (CHEBI:2668) |
| (S)-amlodipine (CHEBI:53796) is enantiomer of (R)-amlodipine (CHEBI:53795) |
| Incoming Relation(s) |
| (R)-amlodipine (CHEBI:53795) is enantiomer of (S)-amlodipine (CHEBI:53796) |
| IUPAC Name |
|---|
| 3-ethyl 5-methyl (4S)-2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| Manual Xrefs | Databases |
|---|---|
| 4099 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5857143 | Reaxys |