EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25ClN2O5.C6H6O3S |
| Net Charge | 0 |
| Average Mass | 567.060 |
| Monoisotopic Mass | 566.14896 |
| SMILES | CCOC(=O)C1=C(COCCN)NC(C)=C(C(=O)OC)C1c1ccccc1Cl.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C20H25ClN2O5.C6H6O3S/c1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21;7-10(8,9)6-4-2-1-3-5-6/h5-8,17,23H,4,9-11,22H2,1-3H3;1-5H,(H,7,8,9) |
| InChIKey | ZPBWCRDSRKPIDG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amlodipine benzenesulfonate (CHEBI:2669) has part amlodipine (CHEBI:2668) |
| amlodipine benzenesulfonate (CHEBI:2669) has role antihypertensive agent (CHEBI:35674) |
| amlodipine benzenesulfonate (CHEBI:2669) has role calcium channel blocker (CHEBI:38215) |
| amlodipine benzenesulfonate (CHEBI:2669) has role vasodilator agent (CHEBI:35620) |
| amlodipine benzenesulfonate (CHEBI:2669) is a organosulfonate salt (CHEBI:64382) |
| Incoming Relation(s) |
| Prestalia (CHEBI:85999) has part amlodipine benzenesulfonate (CHEBI:2669) |
| IUPAC Name |
|---|
| 3-ethyl 5-methyl 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate benzenesulfonate |
| INNs | Source |
|---|---|
| amlodipine | ChEBI |
| amlodipino | DrugBank |
| amlodipinum | DrugBank |
| Synonyms | Source |
|---|---|
| Amlodipine besilate | KEGG DRUG |
| Amlodipine besylate | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8378713 | Beilstein |
| CAS:111470-99-6 | KEGG DRUG |
| CAS:111470-99-6 | ChemIDplus |